Difference between revisions of "CPD-5881"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_000170 == * left end position: ** 158660 * transcription direction: ** POSITIVE * right end position: ** 164963 * centisome position: ** 1.9032...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * inchi key: **...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 4α-hydroxy-tetrahydrobiopterin |
| − | * | + | * molecular weight: |
| − | ** | + | ** 257.249 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4α-hydroxy-5,6,7,8-tetrahydrobiopterin |
| − | ** | + | ** 4α-hydroxy-tetrahydropterin |
| + | ** 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-7908]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-569]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657593 90657593] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15374 15374] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15522 C15522] |
| − | {{#set: | + | * HMDB : HMDB02281 |
| + | {{#set: smiles=CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))}} | ||
| + | {{#set: inchi key=InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N}} | ||
| + | {{#set: common name=4α-hydroxy-tetrahydrobiopterin}} | ||
| + | {{#set: molecular weight=257.249 }} | ||
| + | {{#set: common name=4α-hydroxy-5,6,7,8-tetrahydrobiopterin|4α-hydroxy-tetrahydropterin|6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin}} | ||
| + | {{#set: consumed by=RXN-7908}} | ||
| + | {{#set: produced by=RXN66-569}} | ||
Latest revision as of 19:55, 21 March 2018
Contents
Metabolite CPD-5881
- smiles:
- CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))
- inchi key:
- InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N
- common name:
- 4α-hydroxy-tetrahydrobiopterin
- molecular weight:
- 257.249
- Synonym(s):
- 4α-hydroxy-5,6,7,8-tetrahydrobiopterin
- 4α-hydroxy-tetrahydropterin
- 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))" cannot be used as a page name in this wiki.
