Difference between revisions of "Charged-LYS-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-LYS-tRNAs Charged-LYS-tRNAs] == * common name: ** an L-lysyl-[tRNAlys] * Synonym(s): =...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-LYS-tRNAs Charged-LYS-tRNAs] ==
* smiles:
+
** CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
* inchi key:
+
** InChIKey=MMZJVINJFSRJOK-CYNJBPNESA-J
+
 
* common name:
 
* common name:
** (2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
+
** an L-lysyl-[tRNAlys]
* molecular weight:
+
** 1102.034   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16131]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16130]]
+
* [[LYSINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an L-lysyl-[tRNAlys]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551529 72551529]
+
{{#set: produced by=LYSINE--TRNA-LIGASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76464 76464]
+
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: inchi key=InChIKey=MMZJVINJFSRJOK-CYNJBPNESA-J}}
+
{{#set: common name=(2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA}}
+
{{#set: molecular weight=1102.034    }}
+
{{#set: consumed by=RXN-16131}}
+
{{#set: produced by=RXN-16130}}
+

Latest revision as of 19:55, 21 March 2018

Metabolite Charged-LYS-tRNAs

  • common name:
    • an L-lysyl-[tRNAlys]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an L-lysyl-[tRNAlys" cannot be used as a page name in this wiki.