Difference between revisions of "Ec-15 001600"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G3P G3P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(=O)[O-] * inchi key: ** InChIKey=OSJPPGNTCRNQ...") |
(Created page with "Category:Gene == Gene Ec-15_001600 == * left end position: ** 1810960 * transcription direction: ** NEGATIVE * right end position: ** 1833163 * centisome position: ** 33.5...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-15_001600 == |
− | * | + | * left end position: |
− | ** | + | ** 1810960 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1833163 |
− | * | + | * centisome position: |
− | ** | + | ** 33.54715 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0056_0068 |
− | ** | + | ** Esi0056_0068 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[5.99.1.2-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * | + | *** Assignment: go-term |
− | * [[ | + | * Reaction: [[5.99.1.3-RXN]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: automated-name-match | |
− | * | + | == Pathways associated == |
− | * [[ | + | |
− | * [[ | + | |
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1810960}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1833163}} | |
− | + | {{#set: centisome position=33.54715 }} | |
− | + | {{#set: common name=Esi_0056_0068|Esi0056_0068}} | |
− | + | {{#set: reaction associated=5.99.1.2-RXN|5.99.1.3-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:55, 21 March 2018
Gene Ec-15_001600
- left end position:
- 1810960
- transcription direction:
- NEGATIVE
- right end position:
- 1833163
- centisome position:
- 33.54715
- Synonym(s):
- Esi_0056_0068
- Esi0056_0068
Reactions associated
- Reaction: 5.99.1.2-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: 5.99.1.3-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome