Difference between revisions of "CPD-7100"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_001720 == * left end position: ** 1725008 * transcription direction: ** NEGATIVE * right end position: ** 1731680 * centisome position: ** 33.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * inchi key: ** InChIKey=HII...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L |
| − | * | + | * common name: |
| − | ** | + | ** (2S)-2-isopropyl-3-oxosuccinate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 172.137 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-isopropyl-3-oxosuccinate |
| − | + | ||
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-7800]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[RXN- | + | * [[3-ISOPROPYLMALDEHYDROG-RXN]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04236 C04236] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17214 17214] |
| − | {{#set: common name= | + | * BIGG : 43420 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419705 6419705] |
| + | * HMDB : HMDB12149 | ||
| + | {{#set: smiles=CC(C(C(=O)[O-])C(=O)C(=O)[O-])C}} | ||
| + | {{#set: inchi key=InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L}} | ||
| + | {{#set: common name=(2S)-2-isopropyl-3-oxosuccinate}} | ||
| + | {{#set: molecular weight=172.137 }} | ||
| + | {{#set: common name=2-isopropyl-3-oxosuccinate}} | ||
| + | {{#set: consumed by=RXN-7800}} | ||
| + | {{#set: reversible reaction associated=3-ISOPROPYLMALDEHYDROG-RXN}} | ||
Latest revision as of 19:55, 21 March 2018
Contents
Metabolite CPD-7100
- smiles:
- CC(C(C(=O)[O-])C(=O)C(=O)[O-])C
- inchi key:
- InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L
- common name:
- (2S)-2-isopropyl-3-oxosuccinate
- molecular weight:
- 172.137
- Synonym(s):
- 2-isopropyl-3-oxosuccinate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(C(=O)[O-])C(=O)C(=O)[O-])C" cannot be used as a page name in this wiki.
