|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O) |
| + | * inchi key: |
| + | ** InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L |
| * common name: | | * common name: |
− | ** putative ribulose-1,5-bisphosphate carboxylase/oxygenase small subunit N-methyltransferase I | + | ** (3Z)-phytochromobilin |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/4.1.1.39 EC-4.1.1.39] | + | ** 582.655 |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[WATER]][c] '''+''' 1 [[D-RIBULOSE-15-P2]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''=>''' 2 [[G3P]][c] '''+''' 2 [[PROTON]][c]
| + | * [[1.3.7.4-RXN]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 H2O[c] '''+''' 1 D-ribulose-1,5-bisphosphate[c] '''+''' 1 CO2[c] '''=>''' 2 3-phospho-D-glycerate[c] '''+''' 2 H+[c] | + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-12_007560]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | == Pathways == | + | |
− | * [[PWY-5532]], nucleoside and nucleotide degradation (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5532 PWY-5532]
| + | |
− | ** '''2''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[CALVIN-PWY]], Calvin-Benson-Bassham cycle: [http://metacyc.org/META/NEW-IMAGE?object=CALVIN-PWY CALVIN-PWY]
| + | |
− | ** '''13''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[PWY-5723]], Rubisco shunt: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5723 PWY-5723]
| + | |
− | ** '''10''' reactions found over '''10''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23124 23124] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246013 25246013] |
− | * LIGAND-RXN:
| + | {{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00024 R00024]
| + | {{#set: inchi key=InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L}} |
− | * UNIPROT:
| + | {{#set: common name=(3Z)-phytochromobilin}} |
− | ** [http://www.uniprot.org/uniprot/P00875 P00875]
| + | {{#set: molecular weight=582.655 }} |
− | ** [http://www.uniprot.org/uniprot/P56648 P56648]
| + | {{#set: produced by=1.3.7.4-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q7M229 Q7M229]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M1Q6 Q7M1Q6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24672 P24672]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24673 P24673]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9MVE5 Q9MVE5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48713 P48713]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09119 Q09119]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28896 P28896]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09125 Q09125]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28685 O28685]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28635 O28635]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UZD7 Q9UZD7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20455 P20455]
| + | |
− | ** [http://www.uniprot.org/uniprot/O58677 O58677]
| + | |
− | ** [http://www.uniprot.org/uniprot/O31666 O31666]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59102 Q59102]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42721 P42721]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59462 Q59462]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02980 Q02980]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27065 P27065]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04991 P04991]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00879 P00879]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24395 P24395]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28895 P28895]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05698 P05698]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26958 P26958]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14958 P14958]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31333 P31333]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00872 P00872]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19309 P19309]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19308 P19308]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19311 P19311]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19310 P19310]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19312 P19312]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00878 P00878]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28258 P28258]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19161 P19161]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19162 P19162]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07089 P07089]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08705 P08705]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28260 P28260]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26490 P26490]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16032 P16032]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16134 P16134]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16131 P16131]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16136 P16136]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16132 P16132]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16137 P16137]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16133 P16133]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16138 P16138]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24674 P24674]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26961 P26961]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26964 P26964]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24682 P24682]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17673 P17673]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26959 P26959]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69571 P69571]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26960 P26960]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24681 P24681]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26963 P26963]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24671 P24671]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69570 P69570]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16031 P16031]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24624 P24624]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25458 P25458]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12466 P12466]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00877 P00877]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08211 P08211]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00873 P00873]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08475 P08475]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22849 P22849]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22859 P22859]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22850 P22850]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22860 P22860]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24312 P24312]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08474 P08474]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06292 P06292]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16306 P16306]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14961 P14961]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10795 P10795]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10796 P10796]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10797 P10797]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10798 P10798]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27568 P27568]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22433 P22433]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00876 P00876]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11421 P11421]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11422 P11422]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69249 P69249]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69250 P69250]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26573 P26573]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19163 P19163]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19164 P19164]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25414 P25414]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24313 P24313]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23651 P23651]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23652 P23652]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04992 P04992]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04717 P04717]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00868 P00868]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07689 P07689]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00869 P00869]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26576 P26576]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26577 P26577]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26574 P26574]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26575 P26575]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10647 P10647]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18960 P18960]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24683 P24683]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23011 P23011]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23012 P23012]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27997 P27997]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27998 P27998]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27985 P27985]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05346 P05346]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08135 P08135]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12089 P12089]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05347 P05347]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18566 P18566]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18567 P18567]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00870 P00870]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00865 P00865]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12468 P12468]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24676 P24676]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24678 P24678]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24679 P24679]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24675 P24675]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24677 P24677]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26962 P26962]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10053 P10053]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05349 P05349]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07180 P07180]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08706 P08706]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07179 P07179]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19160 P19160]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11383 P11383]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07398 P07398]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26667 P26667]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00880 P00880]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04716 P04716]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00874 P00874]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05348 P05348]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14957 P14957]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13951 P13951]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16129 P16129]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16130 P16130]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04718 P04718]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05699 P05699]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17537 P17537]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29684 P29684]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27569 P27569]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S932 Q9S932]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26985 P26985]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39387 Q39387]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07087 Q07087]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07088 Q07088]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30401 P30401]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14959 P14959]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43874 Q43874]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25413 P25413]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32753 Q32753]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32764 P32764]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31191 P31191]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31192 P31192]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31190 P31190]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31195 P31195]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31194 P31194]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31193 P31193]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31196 P31196]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31197 P31197]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31199 P31199]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31198 P31198]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31200 P31200]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31201 P31201]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31203 P31203]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31180 P31180]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31182 P31182]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31183 P31183]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31181 P31181]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31184 P31184]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31185 P31185]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69567 P69567]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69568 P69568]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69569 P69569]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31186 P31186]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31188 P31188]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37393 P37393]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37394 P37394]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q31949 Q31949]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07049 Q07049]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39985 Q39985]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34915 P34915]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08186 Q08186]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08184 Q08184]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08183 Q08183]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04450 Q04450]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43746 Q43746]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48711 P48711]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q31847 Q31847]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32017 Q32017]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32250 Q32250]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32379 Q32379]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32463 Q32463]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32788 Q32788]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32847 Q32847]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32903 Q32903]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33040 Q33040]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54205 P54205]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54206 P54206]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48682 P48682]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q31809 Q31809]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q31883 Q31883]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q31942 Q31942]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q31992 Q31992]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32255 Q32255]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32337 Q32337]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32271 Q32271]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32283 Q32283]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32303 Q32303]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32344 Q32344]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32345 Q32345]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32360 Q32360]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32396 Q32396]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q32908 Q32908]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33049 Q33049]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33062 Q33062]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33274 Q33274]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33326 Q33326]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33327 Q33327]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33328 Q33328]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33329 Q33329]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33334 Q33334]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33335 Q33335]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33337 Q33337]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33340 Q33340]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33341 Q33341]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33342 Q33342]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33343 Q33343]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33344 Q33344]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33348 Q33348]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33349 Q33349]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33359 Q33359]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33361 Q33361]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33362 Q33362]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33345 Q33345]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33346 Q33346]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33347 Q33347]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q36352 Q36352]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16881 P16881]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42516 Q42516]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48069 P48069]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48070 P48070]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48072 P48072]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48073 P48073]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48074 P48074]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48075 P48075]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M2E2 Q7M2E2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q31795 Q31795]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28399 P28399]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q37700 Q37700]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51226 P51226]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43832 Q43832]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49521 P49521]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49520 P49520]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22487 O22487]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q37247 Q37247]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41580 Q41580]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18062 P18062]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41621 P41621]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65194 O65194]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50922 P50922]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41406 Q41406]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=putative ribulose-1,5-bisphosphate carboxylase/oxygenase small subunit N-methyltransferase I}}
| + | |
− | {{#set: ec number=EC-4.1.1.39}}
| + | |
− | {{#set: gene associated=Ec-12_007560}} | + | |
− | {{#set: in pathway=PWY-5532|CALVIN-PWY|PWY-5723}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome}} | + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |