Difference between revisions of "2.7.1.150-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APIGENIN APIGENIN] == * smiles: ** C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O) * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.150-RXN 2.7.1.150-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.150-RXN 2.7.1.150-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.7.1.150 EC-2.7.1.150] | |
− | * | + | |
− | ** 2 | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[ATP]][c] '''+''' 1 [[CPD-177]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH]][c] '''+''' 1 [[ADP]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 ATP[c] '''+''' 1 a 1-phosphatidyl-1D-myo-inositol 3-phosphate[c] '''=>''' 1 H+[c] '''+''' 1 1-phosphatidyl-1D-myo-inositol 3,5-bisphosphate[c] '''+''' 1 ADP[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-6352]], 3-phosphoinositide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6352 PWY-6352] | ||
+ | ** '''8''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13609 13609] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05802 R05802] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: ec number=EC-2.7.1.150}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-6352}} |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:56, 21 March 2018
Contents
Reaction 2.7.1.150-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 CPD-177[c] => 1 PROTON[c] + 1 1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH[c] + 1 ADP[c]
- With common name(s):
- 1 ATP[c] + 1 a 1-phosphatidyl-1D-myo-inositol 3-phosphate[c] => 1 H+[c] + 1 1-phosphatidyl-1D-myo-inositol 3,5-bisphosphate[c] + 1 ADP[c]
Genes associated with this reaction
Pathways
- PWY-6352, 3-phosphoinositide biosynthesis: PWY-6352
- 8 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links