Difference between revisions of "APIGENIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APIGENIN APIGENIN] == * smiles: ** C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O) * inchi key...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APIGENIN APIGENIN] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=YQHMWTPYORBCMF-ZZXKWVIFSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 2',4,4',6'-tetrahydroxychalcone |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 272.257 |
* Synonym(s): | * Synonym(s): | ||
| + | ** naringenin chalcone | ||
| + | ** chalconaringenin | ||
| + | ** 2'4'6'4-Tetrahydroxychalcone | ||
| + | ** Isosalipurpol | ||
| + | ** tetrahydroxychalcone | ||
| + | ** 3-(4-hydroxyphemyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[APIGNAR-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 73692-50-9 | ||
| + | * LIPID_MAPS : LMPK12120264 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280960 5280960] |
| − | * | + | * HMDB : HMDB29631 |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06561 C06561] |
| − | * | + | * CHEMSPIDER: |
| − | {{#set: smiles= | + | ** [http://www.chemspider.com/Chemical-Structure.4444447.html 4444447] |
| − | {{#set: inchi key=InChIKey= | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15413 15413] |
| − | {{#set: molecular weight= | + | * METABOLIGHTS : MTBLC15413 |
| − | {{#set: consumed by=RXN- | + | {{#set: smiles=C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O)}} |
| + | {{#set: inchi key=InChIKey=YQHMWTPYORBCMF-ZZXKWVIFSA-N}} | ||
| + | {{#set: common name=2',4,4',6'-tetrahydroxychalcone}} | ||
| + | {{#set: molecular weight=272.257 }} | ||
| + | {{#set: common name=naringenin chalcone|chalconaringenin|2'4'6'4-Tetrahydroxychalcone|Isosalipurpol|tetrahydroxychalcone|3-(4-hydroxyphemyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one}} | ||
| + | {{#set: consumed by=APIGNAR-RXN}} | ||
| + | {{#set: produced by=NARINGENIN-CHALCONE-SYNTHASE-RXN}} | ||
Latest revision as of 19:56, 21 March 2018
Contents
Metabolite APIGENIN
- smiles:
- C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O)
- inchi key:
- InChIKey=YQHMWTPYORBCMF-ZZXKWVIFSA-N
- common name:
- 2',4,4',6'-tetrahydroxychalcone
- molecular weight:
- 272.257
- Synonym(s):
- naringenin chalcone
- chalconaringenin
- 2'4'6'4-Tetrahydroxychalcone
- Isosalipurpol
- tetrahydroxychalcone
- 3-(4-hydroxyphemyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 73692-50-9
- LIPID_MAPS : LMPK12120264
- PUBCHEM:
- HMDB : HMDB29631
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC15413
