Difference between revisions of "PRECURSOR-Z"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SELENOMETHIONINE SELENOMETHIONINE] == * smiles: ** C[Se]CCC(C([O-])=O)[N+] * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRECURSOR-Z PRECURSOR-Z] == * smiles: ** C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRECURSOR-Z PRECURSOR-Z] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4)))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PWFXLXMPGSLEOZ-QQVWSJFJSA-M |
* common name: | * common name: | ||
− | ** | + | ** cyclic pyranopterin phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 344.2 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** precursor Z |
+ | ** cPMP | ||
+ | ** precursor-Z | ||
+ | ** 8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide | ||
+ | ** 8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide | ||
+ | ** cyclic pyranopterin monophosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8342]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-8340]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659039 90659039] |
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59648 59648] |
− | + | {{#set: smiles=C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4))))}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=PWFXLXMPGSLEOZ-QQVWSJFJSA-M}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=cyclic pyranopterin phosphate}} |
− | {{#set: common name= | + | {{#set: molecular weight=344.2 }} |
− | {{#set: molecular weight= | + | {{#set: common name=precursor Z|cPMP|precursor-Z|8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide|8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide|cyclic pyranopterin monophosphate}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-8342}} |
− | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-8340}} |
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite PRECURSOR-Z
- smiles:
- C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4))))
- inchi key:
- InChIKey=PWFXLXMPGSLEOZ-QQVWSJFJSA-M
- common name:
- cyclic pyranopterin phosphate
- molecular weight:
- 344.2
- Synonym(s):
- precursor Z
- cPMP
- precursor-Z
- 8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide
- 8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide
- cyclic pyranopterin monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4))))" cannot be used as a page name in this wiki.
- "8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide" cannot be used as a page name in this wiki.
- "8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide" cannot be used as a page name in this wiki.