Difference between revisions of "Ec-01 004250"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O * inchi...") |
(Created page with "Category:Gene == Gene Ec-01_004250 == * left end position: ** 3645598 * transcription direction: ** POSITIVE * right end position: ** 3653664 * centisome position: ** 35.3...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_004250 == |
− | * | + | * left end position: |
− | ** | + | ** 3645598 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3653664 |
− | * | + | * centisome position: |
− | ** | + | ** 35.32955 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0145_0051 |
− | ** | + | ** Esi0145_0051 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[DAHPSYN-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-aragem]] |
+ | == Pathways associated == | ||
+ | * [[PWY-6164]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3645598}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3653664}} | |
− | + | {{#set: centisome position=35.32955 }} | |
− | + | {{#set: common name=Esi_0145_0051|Esi0145_0051}} | |
− | + | {{#set: reaction associated=DAHPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-6164}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:58, 21 March 2018
Gene Ec-01_004250
- left end position:
- 3645598
- transcription direction:
- POSITIVE
- right end position:
- 3653664
- centisome position:
- 35.32955
- Synonym(s):
- Esi_0145_0051
- Esi0145_0051
Reactions associated
- Reaction: DAHPSYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome