Difference between revisions of "RXN-11784"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11784 RXN-11784] == * direction: ** LEFT-TO-RIGHT * common name: ** primary amine oxidase * ec...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11784 RXN-11784] ==
* smiles:
+
* direction:
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M
+
 
* common name:
 
* common name:
** gibberellin A8
+
** primary amine oxidase
* molecular weight:
+
* ec number:
** 363.386   
+
** [http://enzyme.expasy.org/EC/1.4.3.21 EC-1.4.3.21]
 
* Synonym(s):
 
* Synonym(s):
** GA8
 
** 2β-hydroxygibberellin 1
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-115]]
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CADAVERINE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[CPD-12763]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 oxygen[c] '''+''' 1 H2O[c] '''+''' 1 cadaverine[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 ammonium[c] '''+''' 1 5-aminopentanal[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-15_002910]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-15_002920]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203521 25203521]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06740 R06740]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28861 28861]
+
{{#set: common name=primary amine oxidase}}
* LIGAND-CPD:
+
{{#set: ec number=EC-1.4.3.21}}
** [http://www.genome.jp/dbget-bin/www_bget?C03579 C03579]
+
{{#set: gene associated=Ec-15_002910|Ec-15_002920}}
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: in pathway=}}
{{#set: inchi key=InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: common name=gibberellin A8}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
{{#set: molecular weight=363.386    }}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: common name=GA8|2β-hydroxygibberellin 1}}
+
{{#set: produced by=RXN-115}}
+

Latest revision as of 19:58, 21 March 2018

Reaction RXN-11784

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • primary amine oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links