Difference between revisions of "RXN-13990"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == * smiles: ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13990 RXN-13990] == * direction: ** REVERSIBLE * common name: ** L-4-hydroxy-2-oxoglutarate ald...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13990 RXN-13990] ==
* smiles:
+
* direction:
** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
+
 
* common name:
 
* common name:
** 5-hydroxyferulate
+
** L-4-hydroxy-2-oxoglutarate aldolase
* molecular weight:
+
** KDPG/KHG aldolase
** 209.178   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/4.1.3.42 EC-4.1.3.42]
 
* Synonym(s):
 
* Synonym(s):
** 5-hydroxy ferulic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-3422]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-15016]][c] '''<=>''' 1 [[GLYOX]][c] '''+''' 1 [[PYRUVATE]][c]
* [[RXN-1121]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 (4S)-4-hydroxy-2-oxoglutarate[c] '''<=>''' 1 glyoxylate[c] '''+''' 1 pyruvate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_004070]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740354 54740354]
+
{{#set: common name=L-4-hydroxy-2-oxoglutarate aldolase}}
* LIGAND-CPD:
+
{{#set: common name=KDPG/KHG aldolase}}
** [http://www.genome.jp/dbget-bin/www_bget?C05619 C05619]
+
{{#set: ec number=EC-4.1.3.42}}
* HMDB : HMDB35484
+
{{#set: gene associated=Ec-27_004070}}
{{#set: smiles=COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)}}
+
{{#set: in pathway=}}
{{#set: inchi key=InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M}}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=5-hydroxyferulate}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: molecular weight=209.178    }}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=5-hydroxy ferulic acid}}
+
{{#set: consumed by=RXN-3422}}
+
{{#set: produced by=RXN-1121}}
+

Latest revision as of 19:58, 21 March 2018

Reaction RXN-13990

  • direction:
    • REVERSIBLE
  • common name:
    • L-4-hydroxy-2-oxoglutarate aldolase
    • KDPG/KHG aldolase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (4S)-4-hydroxy-2-oxoglutarate[c] <=> 1 glyoxylate[c] + 1 pyruvate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links