Difference between revisions of "Ec-08 002600"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Ec-08_002600 == * left end position: ** 2408123 * transcription direction: ** POSITIVE * right end position: ** 2411866 * centisome position: ** 35.9...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_002600 == |
− | * | + | * left end position: |
− | ** | + | ** 2408123 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2411866 |
− | * | + | * centisome position: |
− | ** | + | ** 35.957882 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0007_0202 |
− | ** | + | ** Esi0007_0202 |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.1.3.16-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[4-NITROPHENYLPHOSPHATASE-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2408123}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2411866}} | |
− | + | {{#set: centisome position=35.957882 }} | |
− | {{#set: | + | {{#set: common name=Esi_0007_0202|Esi0007_0202}} |
− | {{#set: | + | {{#set: reaction associated=3.1.3.16-RXN|4-NITROPHENYLPHOSPHATASE-RXN|PROTEIN-TYROSINE-PHOSPHATASE-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:58, 21 March 2018
Gene Ec-08_002600
- left end position:
- 2408123
- transcription direction:
- POSITIVE
- right end position:
- 2411866
- centisome position:
- 35.957882
- Synonym(s):
- Esi_0007_0202
- Esi0007_0202
Reactions associated
- Reaction: 3.1.3.16-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: 4-NITROPHENYLPHOSPHATASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: PROTEIN-TYROSINE-PHOSPHATASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome