Difference between revisions of "CPD-471"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AICARSYN-RXN AICARSYN-RXN] == * direction: ** REVERSIBLE * common name: ** Adenylosuccinate lyase C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-471 CPD-471] == * smiles: ** CC(C[N+])C([O-])=O * inchi key: ** InChIKey=QCHPKSFMDHPSNR-GSV...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-471 CPD-471] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C[N+])C([O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=QCHPKSFMDHPSNR-GSVOUGTGSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** (R)-3-amino-2-methylpropanoate |
− | * | + | * molecular weight: |
− | ** | + | ** 103.121 |
* Synonym(s): | * Synonym(s): | ||
+ | ** D-3-amino-isobutanoate | ||
+ | ** 2-methyl-β-alanine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-11210]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01205 C01205] | |
− | * LIGAND- | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57731 57731] |
− | * | + | * METABOLIGHTS : MTBLC57731 |
− | ** [http://www. | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971064 6971064] | |
− | * | + | * HMDB : HMDB02299 |
− | * | + | {{#set: smiles=CC(C[N+])C([O-])=O}} |
− | ** [http:// | + | {{#set: inchi key=InChIKey=QCHPKSFMDHPSNR-GSVOUGTGSA-N}} |
− | + | {{#set: common name=(R)-3-amino-2-methylpropanoate}} | |
− | + | {{#set: molecular weight=103.121 }} | |
− | * | + | {{#set: common name=D-3-amino-isobutanoate|2-methyl-β-alanine}} |
− | {{#set: | + | {{#set: produced by=RXN-11210}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite CPD-471
- smiles:
- CC(C[N+])C([O-])=O
- inchi key:
- InChIKey=QCHPKSFMDHPSNR-GSVOUGTGSA-N
- common name:
- (R)-3-amino-2-methylpropanoate
- molecular weight:
- 103.121
- Synonym(s):
- D-3-amino-isobutanoate
- 2-methyl-β-alanine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C[N+])C([O-])=O" cannot be used as a page name in this wiki.