Difference between revisions of "Ec-01 008900"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17346 CPD-17346] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Gene == Gene Ec-01_008900 == * left end position: ** 7525434 * transcription direction: ** NEGATIVE * right end position: ** 7540443 * centisome position: ** 72.9...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17346 CPD-17346] ==
+
== Gene Ec-01_008900 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 7525434
−
* common name:
+
* transcription direction:
−
** 3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA
+
** NEGATIVE
−
* inchi key:
+
* right end position:
−
** InChIKey=PUWDUOCPCWFEFG-YGYQDCEASA-J
+
** 7540443
−
* molecular weight:
+
* centisome position:
−
** 1067.974    
+
** 72.929115    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0203_0013
 +
** Esi0203_0013
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16095]]
+
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-16094]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=7525434}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581045 71581045]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=7540443}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74012 74012]
+
{{#set: centisome position=72.929115    }}
−
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0203_0013|Esi0203_0013}}
−
{{#set: common name=3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA}}
+
{{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: inchi key=InChIKey=PUWDUOCPCWFEFG-YGYQDCEASA-J}}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: molecular weight=1067.974    }}
+
−
{{#set: consumed by=RXN-16095}}
+
−
{{#set: produced by=RXN-16094}}
+

Latest revision as of 20:58, 21 March 2018

Gene Ec-01_008900

  • left end position:
    • 7525434
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 7540443
  • centisome position:
    • 72.929115
  • Synonym(s):
    • Esi_0203_0013
    • Esi0203_0013

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_008900&oldid=30644"