Difference between revisions of "CPD-11665"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_002050 == * left end position: ** 1989804 * transcription direction: ** NEGATIVE * right end position: ** 1992030 * centisome position: ** 30.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N |
| − | * | + | * common name: |
| − | ** | + | ** serotonin O-sulfate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 256.276 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 5-hydroxytryptamine O-sulfate |
| − | ** | + | ** 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate |
| + | ** 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester) | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10777]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=152151 152151] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.134104.html 134104] |
| − | {{#set: common name= | + | {{#set: smiles=C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))}} |
| − | + | {{#set: inchi key=InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N}} | |
| − | {{#set: | + | {{#set: common name=serotonin O-sulfate}} |
| + | {{#set: molecular weight=256.276 }} | ||
| + | {{#set: common name=5-hydroxytryptamine O-sulfate|3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate|1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)}} | ||
| + | {{#set: produced by=RXN-10777}} | ||
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite CPD-11665
- smiles:
- C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
- inchi key:
- InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
- common name:
- serotonin O-sulfate
- molecular weight:
- 256.276
- Synonym(s):
- 5-hydroxytryptamine O-sulfate
- 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
- 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
