Difference between revisions of "S-ubiquitinyl-UCP-E2-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KYNURENATE KYNURENATE] == * smiles: ** C1(C=C2(C(=CC=1)N=C(C(=O)[O-])C=C([O-])2)) * inchi key:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-UCP-E2-L-cysteine S-ubiquitinyl-UCP-E2-L-cysteine] == * common name: ** an S-ubiq...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KYNURENATE KYNURENATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-UCP-E2-L-cysteine S-ubiquitinyl-UCP-E2-L-cysteine] ==
−
* smiles:
+
−
** C1(C=C2(C(=CC=1)N=C(C(=O)[O-])C=C([O-])2))
+
−
* inchi key:
+
−
** InChIKey=HCZHHEIFKROPDY-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** kynurenate
+
** an S-ubiquitinyl-[E2 ubiquitin-conjugating enzyme]-L-cysteine
−
* molecular weight:
+
−
** 187.154   
+
 
* Synonym(s):
 
* Synonym(s):
−
** kynurenic acid
+
** an S-ubiquitinyl-[ubiquitin-conjugating enzyme E2]-L-cysteine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15559]]
 +
* [[RXN-15561]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10720]]
+
* [[RXN-15556]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 492-27-3
+
{{#set: common name=an S-ubiquitinyl-[E2 ubiquitin-conjugating enzyme]-L-cysteine}}
−
* PUBCHEM:
+
{{#set: common name=an S-ubiquitinyl-[ubiquitin-conjugating enzyme E2]-L-cysteine}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201402 25201402]
+
{{#set: consumed by=RXN-15559|RXN-15561}}
−
* HMDB : HMDB00715
+
{{#set: produced by=RXN-15556}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01717 C01717]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18344 18344]
+
−
* METABOLIGHTS : MTBLC18344
+
−
{{#set: smiles=C1(C=C2(C(=CC=1)N=C(C(=O)[O-])C=C([O-])2))}}
+
−
{{#set: inchi key=InChIKey=HCZHHEIFKROPDY-UHFFFAOYSA-L}}
+
−
{{#set: common name=kynurenate}}
+
−
{{#set: molecular weight=187.154    }}
+
−
{{#set: common name=kynurenic acid}}
+
−
{{#set: produced by=RXN-10720}}
+

Latest revision as of 19:58, 21 March 2018

Metabolite S-ubiquitinyl-UCP-E2-L-cysteine

  • common name:
    • an S-ubiquitinyl-[E2 ubiquitin-conjugating enzyme]-L-cysteine
  • Synonym(s):
    • an S-ubiquitinyl-[ubiquitin-conjugating enzyme E2]-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an S-ubiquitinyl-[E2 ubiquitin-conjugating enzyme]-L-cysteine" cannot be used as a page name in this wiki.
"an S-ubiquitinyl-[ubiquitin-conjugating enzyme E2]-L-cysteine" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=S-ubiquitinyl-UCP-E2-L-cysteine&oldid=30676"