Difference between revisions of "3-Oxo-octanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6-PYRUVOYL-5678-TETRAHYDROPTERIN 6-PYRUVOYL-5678-TETRAHYDROPTERIN] == * smiles: ** CC(=O)C(=O)[...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Oxo-octanoyl-ACPs 3-Oxo-octanoyl-ACPs] == * common name: ** a 3-oxo-octanoyl-[acp] * Synonym(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6-PYRUVOYL-5678-TETRAHYDROPTERIN 6-PYRUVOYL-5678-TETRAHYDROPTERIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Oxo-octanoyl-ACPs 3-Oxo-octanoyl-ACPs] ==
−
* smiles:
+
−
** CC(=O)C(=O)[CH]1(CNC2(N=C(N)NC(=O)C(N1)=2))
+
−
* inchi key:
+
−
** InChIKey=WBJZXBUVECZHCE-SCSAIBSYSA-N
+
 
* common name:
 
* common name:
−
** 6-pyruvoyl tetrahydropterin
+
** a 3-oxo-octanoyl-[acp]
−
* molecular weight:
+
−
** 237.218   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 6-pyruvoyl-5,6,7,8-tetrahydropterin
+
** a 3-oxo-octanoyl-[acyl-carrier-protein]
−
** 6-(1,2-Dioxopropyl)-5,6,7,8-tetrahydropterin
+
−
** pyruvoyl-H4-pterin
+
−
** PPH4
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-8853]]
+
* [[RXN-14973]]
 +
* [[RXN-9524]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[4.2.3.12-RXN]]
+
* [[RXN-9523]]
 +
* [[RXN-14972]]
 +
* [[RXN-9650]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a 3-oxo-octanoyl-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644062 644062]
+
{{#set: common name=a 3-oxo-octanoyl-[acyl-carrier-protein]}}
−
* HMDB : HMDB01195
+
{{#set: consumed by=RXN-14973|RXN-9524}}
−
* LIGAND-CPD:
+
{{#set: produced by=RXN-9523|RXN-14972|RXN-9650}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03684 C03684]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.114280.html 114280]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17804 17804]
+
−
* METABOLIGHTS : MTBLC17804
+
−
{{#set: smiles=CC(=O)C(=O)[CH]1(CNC2(N=C(N)NC(=O)C(N1)=2))}}
+
−
{{#set: inchi key=InChIKey=WBJZXBUVECZHCE-SCSAIBSYSA-N}}
+
−
{{#set: common name=6-pyruvoyl tetrahydropterin}}
+
−
{{#set: molecular weight=237.218    }}
+
−
{{#set: common name=6-pyruvoyl-5,6,7,8-tetrahydropterin|6-(1,2-Dioxopropyl)-5,6,7,8-tetrahydropterin|pyruvoyl-H4-pterin|PPH4}}
+
−
{{#set: consumed by=RXN-8853}}
+
−
{{#set: produced by=4.2.3.12-RXN}}
+

Latest revision as of 19:58, 21 March 2018

Metabolite 3-Oxo-octanoyl-ACPs

  • common name:
    • a 3-oxo-octanoyl-[acp]
  • Synonym(s):
    • a 3-oxo-octanoyl-[acyl-carrier-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-octanoyl-[acp" cannot be used as a page name in this wiki.
"a 3-oxo-octanoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-Oxo-octanoyl-ACPs&oldid=30690"