Difference between revisions of "TRNA-uridine-38-40"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] == * smiles: ** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine-38-40 tRNA-uridine-38-40] == * common name: ** a uridine38-40 in tRNA * Synonym(s)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine-38-40 tRNA-uridine-38-40] ==
* smiles:
+
** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))
+
* inchi key:
+
** InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M
+
 
* common name:
 
* common name:
** geranylgeranyl chlorophyll a
+
** a uridine38-40 in tRNA
* molecular weight:
+
** 886.447   
+
 
* Synonym(s):
 
* Synonym(s):
** geranylgeranyl-chl a
+
** a tRNA uridine38-40
** GG-chl a
+
** GG-chlorophyll a
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7664]]
+
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
* [[RXN-17428]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a uridine38-40 in tRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657538 90657538]
+
{{#set: common name=a tRNA uridine38-40}}
* CHEBI:
+
{{#set: consumed by=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64668 64668]
+
{{#set: smiles=C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))}}
+
{{#set: inchi key=InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M}}
+
{{#set: common name=geranylgeranyl chlorophyll a}}
+
{{#set: molecular weight=886.447    }}
+
{{#set: common name=geranylgeranyl-chl a|GG-chl a|GG-chlorophyll a}}
+
{{#set: consumed by=RXN-7664|RXN-17428}}
+

Latest revision as of 19:58, 21 March 2018

Metabolite tRNA-uridine-38-40

  • common name:
    • a uridine38-40 in tRNA
  • Synonym(s):
    • a tRNA uridine38-40

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links