Difference between revisions of "RXN-7919"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == * smiles: ** C(OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inch...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7919 RXN-7919] == * direction: ** LEFT-TO-RIGHT * common name: ** hydroxyacylglutathione hydrol...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7919 RXN-7919] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** hydroxyacylglutathione hydrolase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.1.2.6 EC-3.1.2.6] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[WATER]][c] '''+''' 1 [[2-hydroxyacyl-glutathiones]][c] '''=>''' 1 [[2-Hydroxy-carboxylates]][c] '''+''' 1 [[GLUTATHIONE]][c] | |
| − | + | * With common name(s): | |
| − | + | ** 1 H2O[c] '''+''' 1 S-(2-hydroxyacyl)glutathione[c] '''=>''' 1 a 2-hydroxy carboxylate[c] '''+''' 1 glutathione[c] | |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Ec-06_010680]] |
| − | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
| − | == | + | *** Assignment: GO-TERM |
| − | * [[ | + | * Gene: [[Ec-04_001020]] |
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: GO-TERM | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04090 R04090] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=hydroxyacylglutathione hydrolase}} | |
| − | + | {{#set: ec number=EC-3.1.2.6}} | |
| − | * LIGAND- | + | {{#set: gene associated=Ec-06_010680|Ec-04_001020}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=}} |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:11, 21 March 2018
Contents
Reaction RXN-7919
- direction:
- LEFT-TO-RIGHT
- common name:
- hydroxyacylglutathione hydrolase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 2-hydroxyacyl-glutathiones[c] => 1 2-Hydroxy-carboxylates[c] + 1 GLUTATHIONE[c]
- With common name(s):
- 1 H2O[c] + 1 S-(2-hydroxyacyl)glutathione[c] => 1 a 2-hydroxy carboxylate[c] + 1 glutathione[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-06_010680
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-04_001020
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN:
