Difference between revisions of "CPD-8122"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == * smiles: ** C1(=CC=C(C=C1)[N+]([O-])=O) * inchi key: ** InChIKey=L...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K |
* common name: | * common name: | ||
− | ** | + | ** molybdopterin adenine dinucleotide |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 721.529 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** adenylated molybdopterin |
− | ** | + | ** H2Dtpp-mADP |
+ | ** molybdopterin-AMP | ||
+ | ** adenylyl-molybdopterin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-8348]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8344]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727] |
− | {{#set: smiles= | + | {{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}} |
− | {{#set: common name= | + | {{#set: common name=molybdopterin adenine dinucleotide}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=721.529 }} |
− | {{#set: common name= | + | {{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}} |
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-8348}} |
+ | {{#set: produced by=RXN-8344}} |
Latest revision as of 20:58, 21 March 2018
Contents
Metabolite CPD-8122
- smiles:
- C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))
- inchi key:
- InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
- common name:
- molybdopterin adenine dinucleotide
- molecular weight:
- 721.529
- Synonym(s):
- adenylated molybdopterin
- H2Dtpp-mADP
- molybdopterin-AMP
- adenylyl-molybdopterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))" cannot be used as a page name in this wiki.