Difference between revisions of "ADENOSYL-P4"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYL-P4 ADENOSYL-P4] == * smiles: ** C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(O...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYL-P4 ADENOSYL-P4] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=YOAHKNVSNCMZGQ-XPWFQUROSA-J |
* common name: | * common name: | ||
− | ** | + | ** 5',5'''-diadenosine tetraphosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 832.36 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Ap4A |
− | ** | + | ** AppppA |
− | ** | + | ** P(1),P(4)-bis(5'-adenosyl)tetraphosphate |
+ | ** P1,P4-bis(5'-adenosyl)tetraphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[ATP-ADENYLYLTRANSFERASE-RXN]] |
== External links == | == External links == | ||
+ | * BIGG : 1484745 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243905 25243905] |
+ | * HMDB : HMDB01211 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01260 C01260] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58141 58141] |
− | {{#set: smiles=C( | + | * METABOLIGHTS : MTBLC58141 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=YOAHKNVSNCMZGQ-XPWFQUROSA-J}} |
− | {{#set: molecular weight= | + | {{#set: common name=5',5'''-diadenosine tetraphosphate}} |
− | {{#set: common name= | + | {{#set: molecular weight=832.36 }} |
− | {{#set: reversible reaction associated= | + | {{#set: common name=Ap4A|AppppA|P(1),P(4)-bis(5'-adenosyl)tetraphosphate|P1,P4-bis(5'-adenosyl)tetraphosphate}} |
+ | {{#set: reversible reaction associated=ATP-ADENYLYLTRANSFERASE-RXN}} |
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite ADENOSYL-P4
- smiles:
- C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O
- inchi key:
- InChIKey=YOAHKNVSNCMZGQ-XPWFQUROSA-J
- common name:
- 5',5-diadenosine tetraphosphate
- molecular weight:
- 832.36
- Synonym(s):
- Ap4A
- AppppA
- P(1),P(4)-bis(5'-adenosyl)tetraphosphate
- P1,P4-bis(5'-adenosyl)tetraphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 1484745
- PUBCHEM:
- HMDB : HMDB01211
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58141
"C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.