Difference between revisions of "FLAVONADPREDUCT-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FLAVONADPREDUCT-RXN FLAVONADPREDUCT-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ferredo...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FLAVONADPREDUCT-RXN FLAVONADPREDUCT-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ferredoxin-NADP+ reductase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.18.1.2 EC-1.18.1.2] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[Oxidized-flavodoxins]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[Reduced-flavodoxins]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 an oxidized flavodoxin[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 a reduced flavodoxin[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-03_002800]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P22570 P22570] |
− | * | + | ** [http://www.uniprot.org/uniprot/P24134 P24134] |
− | * | + | ** [http://www.uniprot.org/uniprot/P41343 P41343] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q00598 Q00598] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q44532 Q44532] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9JRE3 Q9JRE3] |
− | * | + | ** [http://www.uniprot.org/uniprot/P08165 P08165] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q7M1T0 Q7M1T0] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q7M1S9 Q7M1S9] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00454 P00454] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00455 P00455] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P10933 P10933] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M1R4 Q7M1R4] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P28861 P28861] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q41736 Q41736] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q61578 Q61578] |
+ | ** [http://www.uniprot.org/uniprot/P48360 P48360] | ||
+ | ** [http://www.uniprot.org/uniprot/Q41641 Q41641] | ||
+ | ** [http://www.uniprot.org/uniprot/Q55318 Q55318] | ||
+ | ** [http://www.uniprot.org/uniprot/O04397 O04397] | ||
+ | ** [http://www.uniprot.org/uniprot/O23877 O23877] | ||
+ | ** [http://www.uniprot.org/uniprot/P41345 P41345] | ||
+ | ** [http://www.uniprot.org/uniprot/O04977 O04977] | ||
+ | ** [http://www.uniprot.org/uniprot/P41344 P41344] | ||
+ | ** [http://www.uniprot.org/uniprot/O65206 O65206] | ||
+ | ** [http://www.uniprot.org/uniprot/O65208 O65208] | ||
+ | ** [http://www.uniprot.org/uniprot/P53991 P53991] | ||
+ | ** [http://www.uniprot.org/uniprot/O59710 O59710] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=ferredoxin-NADP+ reductase}} | ||
+ | {{#set: ec number=EC-1.18.1.2}} | ||
+ | {{#set: gene associated=Ec-03_002800}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:00, 21 March 2018
Contents
Reaction FLAVONADPREDUCT-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- ferredoxin-NADP+ reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Oxidized-flavodoxins[c] + 1 PROTON[c] + 1 NADPH[c] => 1 NADP[c] + 1 Reduced-flavodoxins[c]
- With common name(s):
- 1 an oxidized flavodoxin[c] + 1 H+[c] + 1 NADPH[c] => 1 NADP+[c] + 1 a reduced flavodoxin[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-03_002800
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- UNIPROT: