Difference between revisions of "CPD-13014"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * inchi key: ** InChIKey=KDXKERNSBIXSRK-YFK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == * smiles: ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O * inchi key: ** InChIKey=...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** tributyrin |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 302.367 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** butyryl triglyceride |
| − | ** | + | ** butanoic acid, 1,2,3-propanetriyl ester |
| − | ** | + | ** 1,2,3-tributyrylglycerol |
| − | ** | + | ** tributin |
| − | ** | + | ** tributyrinine |
| − | ** | + | ** glycerol tributyrate |
| + | ** glyceryl tributyrate | ||
| + | ** butyrin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12086]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C13870 C13870] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.13849665.html 13849665] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35020 35020] |
| − | * | + | * PUBCHEM: |
| − | {{#set: smiles= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6050 6050] |
| − | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB31094 |
| − | {{#set: common name= | + | {{#set: smiles=CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=tributyrin}} |
| − | + | {{#set: molecular weight=302.367 }} | |
| − | {{#set: | + | {{#set: common name=butyryl triglyceride|butanoic acid, 1,2,3-propanetriyl ester|1,2,3-tributyrylglycerol|tributin|tributyrinine|glycerol tributyrate|glyceryl tributyrate|butyrin}} |
| + | {{#set: consumed by=RXN-12086}} | ||
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD-13014
- smiles:
- CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O
- inchi key:
- InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N
- common name:
- tributyrin
- molecular weight:
- 302.367
- Synonym(s):
- butyryl triglyceride
- butanoic acid, 1,2,3-propanetriyl ester
- 1,2,3-tributyrylglycerol
- tributin
- tributyrinine
- glycerol tributyrate
- glyceryl tributyrate
- butyrin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
