Difference between revisions of "DNA-N4-Methylcytosine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE BETAINE] == * smiles: ** C[N+](C)(CC([O-])=O)C * inchi key: ** InChIKey=KWIUHFFTVRNATP-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-N4-Methylcytosine DNA-N4-Methylcytosine] == * common name: ** an N4-methylcytosine in DNA *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE BETAINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-N4-Methylcytosine DNA-N4-Methylcytosine] ==
* smiles:
+
** C[N+](C)(CC([O-])=O)C
+
* inchi key:
+
** InChIKey=KWIUHFFTVRNATP-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** glycine betaine
+
** an N4-methylcytosine in DNA
* molecular weight:
+
** 117.147   
+
 
* Synonym(s):
 
* Synonym(s):
** oxyneurine
+
** a DNA-N4-methylcytosine
** lycine
+
** acidin-pepsin
+
** betaine
+
** trimethylammonioacetate
+
** N,N,N-trimethylglycine
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13406]]
+
* [[2.1.1.113-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[BADH-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 107-43-7
+
{{#set: common name=an N4-methylcytosine in DNA}}
* METABOLIGHTS : MTBLC17750
+
{{#set: common name=a DNA-N4-methylcytosine}}
* PUBCHEM:
+
{{#set: produced by=2.1.1.113-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=247 247]
+
* HMDB : HMDB00043
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00719 C00719]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.242.html 242]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17750 17750]
+
* BIGG : 35786
+
* BIGG : glyb
+
{{#set: smiles=C[N+](C)(CC([O-])=O)C}}
+
{{#set: inchi key=InChIKey=KWIUHFFTVRNATP-UHFFFAOYSA-N}}
+
{{#set: common name=glycine betaine}}
+
{{#set: molecular weight=117.147    }}
+
{{#set: common name=oxyneurine|lycine|acidin-pepsin|betaine|trimethylammonioacetate|N,N,N-trimethylglycine}}
+
{{#set: produced by=RXN-13406}}
+
{{#set: reversible reaction associated=BADH-RXN}}
+

Latest revision as of 19:59, 21 March 2018

Metabolite DNA-N4-Methylcytosine

  • common name:
    • an N4-methylcytosine in DNA
  • Synonym(s):
    • a DNA-N4-methylcytosine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links