Difference between revisions of "2-Me-Branched-234-Sat-FA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] == * smiles: ** C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Me-Branched-234-Sat-FA 2-Me-Branched-234-Sat-FA] == * common name: ** a 2-methyl branched 2,3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Me-Branched-234-Sat-FA 2-Me-Branched-234-Sat-FA] ==
−
* smiles:
+
−
** C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J
+
 
* common name:
 
* common name:
−
** acryloyl-CoA
+
** a 2-methyl branched 2,3,4-saturated fatty acid
−
* molecular weight:
+
−
** 817.551   
+
 
* Synonym(s):
 
* Synonym(s):
−
** acrylyl-coenzyme A
 
−
** propenoyl-CoA
 
−
** acrylyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-483]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-472]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-6383]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 5776-58-9
+
{{#set: common name=a 2-methyl branched 2,3,4-saturated fatty acid}}
−
* PUBCHEM:
+
{{#set: consumed by=RXN66-483}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266595 45266595]
+
{{#set: produced by=RXN66-472}}
−
* HMDB : HMDB02307
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00894 C00894]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57367 57367]
+
−
* METABOLIGHTS : MTBLC57367
+
−
{{#set: smiles=C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J}}
+
−
{{#set: common name=acryloyl-CoA}}
+
−
{{#set: molecular weight=817.551    }}
+
−
{{#set: common name=acrylyl-coenzyme A|propenoyl-CoA|acrylyl-CoA}}
+
−
{{#set: reversible reaction associated=RXN-6383}}
+

Latest revision as of 19:59, 21 March 2018

Metabolite 2-Me-Branched-234-Sat-FA

  • common name:
    • a 2-methyl branched 2,3,4-saturated fatty acid
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2-Me-Branched-234-Sat-FA&oldid=30770"