Difference between revisions of "Holo-LYS2-peptidyl-carrier-protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIK...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-LYS2-peptidyl-carrier-protein Holo-LYS2-peptidyl-carrier-protein] == * common name: ** a h...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-LYS2-peptidyl-carrier-protein Holo-LYS2-peptidyl-carrier-protein] ==
* smiles:
+
** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))
+
* inchi key:
+
** InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N
+
 
* common name:
 
* common name:
** trans-3'-hydroxycotinine
+
** a holo-[LYS2 peptidyl-carrier-protein]
* molecular weight:
+
** 192.217   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-161]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-16759]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a holo-[LYS2 peptidyl-carrier-protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107963 107963]
+
{{#set: reversible reaction associated=RXN-16759}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.97080.html 97080]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71182 71182]
+
* METABOLIGHTS : MTBLC71182
+
* HMDB : HMDB01390
+
{{#set: smiles=C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))}}
+
{{#set: inchi key=InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N}}
+
{{#set: common name=trans-3'-hydroxycotinine}}
+
{{#set: molecular weight=192.217    }}
+
{{#set: produced by=RXN66-161}}
+

Latest revision as of 19:59, 21 March 2018

Metabolite Holo-LYS2-peptidyl-carrier-protein

  • common name:
    • a holo-[LYS2 peptidyl-carrier-protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a holo-[LYS2 peptidyl-carrier-protein" cannot be used as a page name in this wiki.