Difference between revisions of "CPD-458"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTANEDIOL BUTANEDIOL] == * smiles: ** CC(C(O)C)O * inchi key: ** InChIKey=OWBTYPJTUOEWEK-QWWZW...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O * inchi key: *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VCWMRQDBPZKXKG-XIDCDEPRSA-N |
* common name: | * common name: | ||
| − | ** | + | ** galactinol |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 342.299 |
* Synonym(s): | * Synonym(s): | ||
| − | ** D | + | ** 1-O-α-D-galactosyl-D-myo-inositol |
| − | + | ** 1-α-D-galactosyl-myo-inositol | |
| − | ** | + | ** α-D-galactosyl-(1->3)-1D-myo-inositol |
| − | ** | + | |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8281]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[2.4.1.67-RXN]] |
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202439 25202439] |
| − | * HMDB : | + | * KEGG-GLYCAN : G10488 |
| + | * HMDB : HMDB05826 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01235 C01235] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17505 17505] |
| − | {{#set: smiles= | + | * METABOLIGHTS : MTBLC17505 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=VCWMRQDBPZKXKG-XIDCDEPRSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: common name=galactinol}} |
| − | {{#set: common name=D | + | {{#set: molecular weight=342.299 }} |
| − | {{#set: reversible reaction associated= | + | {{#set: common name=1-O-α-D-galactosyl-D-myo-inositol|1-α-D-galactosyl-myo-inositol|α-D-galactosyl-(1->3)-1D-myo-inositol}} |
| + | {{#set: consumed by=RXN-8281}} | ||
| + | {{#set: reversible reaction associated=2.4.1.67-RXN}} | ||
Latest revision as of 20:59, 21 March 2018
Contents
Metabolite CPD-458
- smiles:
- C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O
- inchi key:
- InChIKey=VCWMRQDBPZKXKG-XIDCDEPRSA-N
- common name:
- galactinol
- molecular weight:
- 342.299
- Synonym(s):
- 1-O-α-D-galactosyl-D-myo-inositol
- 1-α-D-galactosyl-myo-inositol
- α-D-galactosyl-(1->3)-1D-myo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KEGG-GLYCAN : G10488
- HMDB : HMDB05826
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC17505
"α-D-galactosyl-(1->3)-1D-myo-inositol" cannot be used as a page name in this wiki.
