Difference between revisions of "N-formyl-L-methionyl-tRNAfmet"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] == * smiles: ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-formyl-L-methionyl-tRNAfmet N-formyl-L-methionyl-tRNAfmet] == * common name: ** an N-formyl-L...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-formyl-L-methionyl-tRNAfmet N-formyl-L-methionyl-tRNAfmet] ==
−
* smiles:
+
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))
+
 
* common name:
 
* common name:
−
** Mg-protoporphyrin
+
** an N-formyl-L-methionyl-[initiator tRNAmet]
−
* molecular weight:
+
−
** 582.94   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Mg-protoporphyrin IX
 
−
** magnesium protoporphyrin
 
−
** MgP
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN1F-20]]
+
* [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an N-formyl-L-methionyl-[initiator tRNAmet]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657481 90657481]
+
{{#set: produced by=METHIONYL-TRNA-FORMYLTRANSFERASE-RXN}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60492 60492]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C03516 C03516]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))}}
+
−
{{#set: common name=Mg-protoporphyrin}}
+
−
{{#set: molecular weight=582.94    }}
+
−
{{#set: common name=Mg-protoporphyrin IX|magnesium protoporphyrin|MgP}}
+
−
{{#set: consumed by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}
+
−
{{#set: produced by=RXN1F-20}}
+

Latest revision as of 19:59, 21 March 2018

Metabolite N-formyl-L-methionyl-tRNAfmet

  • common name:
    • an N-formyl-L-methionyl-[initiator tRNAmet]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-formyl-L-methionyl-[initiator tRNAmet" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=N-formyl-L-methionyl-tRNAfmet&oldid=30834"