Difference between revisions of "N-acetyl-D-glucosamine"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == * smiles: ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) * inchi key: ** InChI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-acetyl-D-glucosamine N-acetyl-D-glucosamine] == * common name: ** N-acetyl-D-glucosamine * Sy...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-acetyl-D-glucosamine N-acetyl-D-glucosamine] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** N-acetyl-D-glucosamine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** NAcGlc | ||
+ | ** N-acetylglucosamine | ||
+ | ** GlcNAc | ||
+ | ** 2-acetamido-2-deoxy-D-glucose | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12625]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=N-acetyl-D-glucosamine}} | |
− | + | {{#set: common name=NAcGlc|N-acetylglucosamine|GlcNAc|2-acetamido-2-deoxy-D-glucose}} | |
− | {{#set: | + | {{#set: produced by=RXN-12625}} |
− | + | ||
− | {{#set: common name=2- | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite N-acetyl-D-glucosamine
- common name:
- N-acetyl-D-glucosamine
- Synonym(s):
- NAcGlc
- N-acetylglucosamine
- GlcNAc
- 2-acetamido-2-deoxy-D-glucose