Difference between revisions of "CPD-15979"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == * smiles: ** C1(NC2(=C(N=1)N=CNC(=O)2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15979 CPD-15979] == * common name: ** D-mannopyranose 6-phosphate * Synonym(s): ** D-mannop...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15979 CPD-15979] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** D-mannopyranose 6-phosphate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** D-mannopyranose-6-P | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[MANNPISOM-RXN]] |
| − | * [[ | + | * [[PHOSMANMUT-RXN]] |
== External links == | == External links == | ||
| − | + | {{#set: common name=D-mannopyranose 6-phosphate}} | |
| − | + | {{#set: common name=D-mannopyranose-6-P}} | |
| − | + | {{#set: reversible reaction associated=MANNPISOM-RXN|PHOSMANMUT-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: reversible reaction associated= | + | |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite CPD-15979
- common name:
- D-mannopyranose 6-phosphate
- Synonym(s):
- D-mannopyranose-6-P
