Difference between revisions of "CPD-6746"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OCTAPRENYL-4-HYDROXYBENZOATE 3-OCTAPRENYL-4-HYDROXYBENZOATE] == * smiles: ** CC(=CCCC(=CCCC(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1) * inchi key: **...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L |
* common name: | * common name: | ||
− | ** | + | ** 1D-myo-inositol 2-monophosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
+ | ** D-myo-inositol 2-monophosphate | ||
+ | ** Ins(2)P1 | ||
+ | ** Ins(2)P | ||
+ | ** Ins2P | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7253]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62383 62383] |
− | + | {{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)}} | |
− | + | {{#set: inchi key=InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L}} | |
− | + | {{#set: common name=1D-myo-inositol 2-monophosphate}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=258.121 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=D-myo-inositol 2-monophosphate|Ins(2)P1|Ins(2)P|Ins2P}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-7253}} |
− | {{#set: molecular weight= | + | |
− | {{#set: | + |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite CPD-6746
- smiles:
- C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)
- inchi key:
- InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L
- common name:
- 1D-myo-inositol 2-monophosphate
- molecular weight:
- 258.121
- Synonym(s):
- D-myo-inositol 2-monophosphate
- Ins(2)P1
- Ins(2)P
- Ins2P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEBI:
"C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)" cannot be used as a page name in this wiki.