Difference between revisions of "RXN-11478"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] == * smiles: ** CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11478 RXN-11478] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucose/ribitol dehydrogena...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11478 RXN-11478] ==
−
* smiles:
+
* direction:
−
** CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O)[O-])C(C)C(N=2)=CC3(C(C)=C(C=C)C(=O)N3)))=C(N4)5)))C=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GVTPYCXGTFQZDT-YSSUGPPCSA-M
+
 
* common name:
 
* common name:
−
** red chlorophyll catabolite
+
** Glucose/ribitol dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 624.692   
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** RCC
 
−
** red bilin
 
−
** (7S,8S,101R)-8-(2-carboxyethyl)-17-ethyl-19-formyl-101-(methoxycarbonyl)-3,7,13,18-tetramethyl-2-vinyl-8,23-dihydro-7H-10,12-ethanobiladiene-ab-1,102(21H)-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7741]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Enoylglutaryl-ACP-methyl-esters]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Glutaryl-ACP-methyl-esters]][c]
−
* [[RXN-17253]]
+
* With common name(s):
−
* [[RXN-7740]]
+
** 1 an enoylglutaryl-[acp] methyl ester[c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a glutaryl-[acp] methyl ester[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_002470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
 +
** '''7''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820276 91820276]
+
{{#set: common name=Glucose/ribitol dehydrogenase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.3.1.9}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58716 58716]
+
{{#set: gene associated=Ec-27_002470}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6519}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C18022 C18022]
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O)[O-])C(C)C(N=2)=CC3(C(C)=C(C=C)C(=O)N3)))=C(N4)5)))C=O)}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: inchi key=InChIKey=GVTPYCXGTFQZDT-YSSUGPPCSA-M}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=red chlorophyll catabolite}}
+
−
{{#set: molecular weight=624.692    }}
+
−
{{#set: common name=RCC|red bilin|(7S,8S,101R)-8-(2-carboxyethyl)-17-ethyl-19-formyl-101-(methoxycarbonyl)-3,7,13,18-tetramethyl-2-vinyl-8,23-dihydro-7H-10,12-ethanobiladiene-ab-1,102(21H)-dione}}
+
−
{{#set: consumed by=RXN-7741}}
+
−
{{#set: produced by=RXN-17253|RXN-7740}}
+

Latest revision as of 19:12, 21 March 2018

Reaction RXN-11478

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glucose/ribitol dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6519, 8-amino-7-oxononanoate biosynthesis I: PWY-6519
    • 7 reactions found over 11 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-11478&oldid=25220"