Difference between revisions of "ARG"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-43 PWY-43] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=ODKSFYDXXFIFQ...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ODKSFYDXXFIFQN-BYPYZUCNSA-O |
* common name: | * common name: | ||
− | ** | + | ** L-arginine |
+ | * molecular weight: | ||
+ | ** 175.21 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-amino-5-guanidinovaleric acid | ||
+ | ** R | ||
+ | ** arginine | ||
+ | ** arg | ||
+ | ** L-arg | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[ARGININE--TRNA-LIGASE-RXN]] |
− | ** [[ | + | * [[biomass_rxn]] |
− | + | * [[ARGININE-2-MONOOXYGENASE-RXN]] | |
− | == Reaction(s) | + | * [[1.5.1.19-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
+ | * [[ARGSUCCINLYA-RXN]] | ||
+ | * [[ARGINASE-RXN]] | ||
== External links == | == External links == | ||
− | * | + | * CAS : 74-79-3 |
− | ** [http:// | + | * BIGG : 33707 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549073 1549073] |
− | {{#set: | + | * HMDB : HMDB00517 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00062 C00062] |
− | {{#set: reaction | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.1266045.html 1266045] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32682 32682] | ||
+ | * METABOLIGHTS : MTBLC32682 | ||
+ | {{#set: smiles=C(NC(N)=[N+])CCC([N+])C(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=ODKSFYDXXFIFQN-BYPYZUCNSA-O}} | ||
+ | {{#set: common name=L-arginine}} | ||
+ | {{#set: molecular weight=175.21 }} | ||
+ | {{#set: common name=2-amino-5-guanidinovaleric acid|R|arginine|arg|L-arg}} | ||
+ | {{#set: consumed by=ARGININE--TRNA-LIGASE-RXN|biomass_rxn|ARGININE-2-MONOOXYGENASE-RXN|1.5.1.19-RXN}} | ||
+ | {{#set: reversible reaction associated=ARGSUCCINLYA-RXN|ARGINASE-RXN}} |
Latest revision as of 19:12, 21 March 2018
Contents
Metabolite ARG
- smiles:
- C(NC(N)=[N+])CCC([N+])C(=O)[O-]
- inchi key:
- InChIKey=ODKSFYDXXFIFQN-BYPYZUCNSA-O
- common name:
- L-arginine
- molecular weight:
- 175.21
- Synonym(s):
- 2-amino-5-guanidinovaleric acid
- R
- arginine
- arg
- L-arg
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 74-79-3
- BIGG : 33707
- PUBCHEM:
- HMDB : HMDB00517
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC32682
"C(NC(N)=[N+])CCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.