Difference between revisions of "CPD0-1108"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-10_002190 == * left end position: ** 2284668 * transcription direction: ** POSITIVE * right end position: ** 2287687 * centisome position: ** 35.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1108 CPD0-1108] == * smiles: ** C(C1(C(O)C(O)C(O)O1))O * inchi key: ** InChIKey=HMFHBZSHGG...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1108 CPD0-1108] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C1(C(O)C(O)C(O)O1))O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N |
| − | * | + | * common name: |
| − | ** | + | ** β-D-ribofuranose |
| − | * | + | * molecular weight: |
| − | ** | + | ** 150.131 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-14904]] | |
| − | == | + | * [[RXN0-5305]] |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | * [[ | + | |
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16639 C16639] | |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.394477.html 394477] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47002 47002] |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=447347 447347] | ||
| + | {{#set: smiles=C(C1(C(O)C(O)C(O)O1))O}} | ||
| + | {{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N}} | ||
| + | {{#set: common name=β-D-ribofuranose}} | ||
| + | {{#set: molecular weight=150.131 }} | ||
| + | {{#set: reversible reaction associated=RXN-14904|RXN0-5305}} | ||
Latest revision as of 18:59, 21 March 2018
Contents
Metabolite CPD0-1108
- smiles:
- C(C1(C(O)C(O)C(O)O1))O
- inchi key:
- InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N
- common name:
- β-D-ribofuranose
- molecular weight:
- 150.131
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
