Difference between revisions of "CPD0-1107"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-01_008360 == * left end position: ** 7130127 * transcription direction: ** NEGATIVE * right end position: ** 7132974 * centisome position: ** 69.0...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] == * smiles: ** CC1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=SHZGCJCMOBC...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-01_008360 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] ==
* left end position:
+
* smiles:
** 7130127
+
** CC1(OC(C(C(C1O)O)O)O)
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N
* right end position:
+
* common name:
** 7132974
+
** β-L-fucopyranose
* centisome position:
+
* molecular weight:
** 69.09819    
+
** 164.158    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0002_0022
+
** β-L-fucose
** Esi0002_0022
+
** MRK?
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Source: [[annotation-esiliculosus_genome]]
+
== Reaction(s) of unknown directionality ==
*** Assignment: go-term
+
* [[RXN0-5298]]
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=7130127}}
+
* DRUGBANK : DB03283
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
{{#set: right end position=7132974}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=444863 444863]
{{#set: centisome position=69.09819   }}
+
* HMDB : HMDB59625
{{#set: common name=Esi_0002_0022|Esi0002_0022|MRK?}}
+
* LIGAND-CPD:
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01019 C01019]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.392667.html 392667]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42589 42589]
 +
{{#set: smiles=CC1(OC(C(C(C1O)O)O)O)}}
 +
{{#set: inchi key=InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N}}
 +
{{#set: common name=β-L-fucopyranose}}
 +
{{#set: molecular weight=164.158   }}
 +
{{#set: common name=β-L-fucose}}
 +
{{#set: reversible reaction associated=RXN0-5298}}

Latest revision as of 18:59, 21 March 2018

Metabolite CPD0-1107

  • smiles:
    • CC1(OC(C(C(C1O)O)O)O)
  • inchi key:
    • InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N
  • common name:
    • β-L-fucopyranose
  • molecular weight:
    • 164.158
  • Synonym(s):
    • β-L-fucose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links