Difference between revisions of "PWY-6763"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] == * smiles: ** CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6763 PWY-6763] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40685 TAX-4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6763 PWY-6763] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40685 TAX-40685] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3689 TAX-3689] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** salicortin biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''11''' reactions in the full pathway |
− | * [[ | + | * [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]] |
− | * [[RXN- | + | ** 0 associated gene: |
− | * [ | + | ** 1 reconstruction source(s) associated: |
− | * [ | + | *** [[annotation-esiliculosus_genome]] |
− | = | + | == Reaction(s) not found == |
− | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=BENZOATE--COA-LIGASE-RXN BENZOATE--COA-LIGASE-RXN] |
− | = | + | * [http://metacyc.org/META/NEW-IMAGE?object=BENZYL-ALC-DEHYDROGENASE-RXN BENZYL-ALC-DEHYDROGENASE-RXN] |
− | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11272 RXN-11272] |
− | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12250 RXN-12250] |
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12251 RXN-12251] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12253 RXN-12253] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12255 RXN-12255] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12257 RXN-12257] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12259 RXN-12259] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-6724 RXN-6724] | ||
== External links == | == External links == | ||
− | * | + | * PLANTCYC : PWY-6763 |
− | + | {{#set: taxonomic range=TAX-40685}} | |
− | + | {{#set: taxonomic range=TAX-3689}} | |
− | + | {{#set: common name=salicortin biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=9.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 18:59, 21 March 2018
Pathway PWY-6763
Reaction(s) found
1 reactions found over 11 reactions in the full pathway
- BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
- BENZOATE--COA-LIGASE-RXN
- BENZYL-ALC-DEHYDROGENASE-RXN
- RXN-11272
- RXN-12250
- RXN-12251
- RXN-12253
- RXN-12255
- RXN-12257
- RXN-12259
- RXN-6724
External links
- PLANTCYC : PWY-6763