Difference between revisions of "PANTETHEINE-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == * smiles: ** CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-] * in...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=JDMUPRLRUUMCTL-VIFPVBQESA-L |
* common name: | * common name: | ||
| − | ** 4- | + | ** 4'-phosphopantetheine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 356.33 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** phosphopantotheine |
| + | ** pantetheine 4'-phosphate | ||
| + | ** phosphopantetheine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PANTEPADENYLYLTRAN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.1.4.14-RXN]] | ||
| + | * [[P-PANTOCYSDECARB-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-10811]] |
== External links == | == External links == | ||
| + | * BIGG : 36886 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245905 25245905] |
| − | * | + | * HMDB : HMDB01416 |
| − | ** [http://www. | + | * LIGAND-CPD: |
| − | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01134 C01134] |
| − | {{#set: smiles= | + | * CHEBI: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61723 61723] |
| − | {{#set: common name=4- | + | * METABOLIGHTS : MTBLC61723 |
| − | {{#set: molecular weight= | + | {{#set: smiles=CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-]}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=JDMUPRLRUUMCTL-VIFPVBQESA-L}} |
| − | {{#set: reversible reaction associated=RXN- | + | {{#set: common name=4'-phosphopantetheine}} |
| + | {{#set: molecular weight=356.33 }} | ||
| + | {{#set: common name=phosphopantotheine|pantetheine 4'-phosphate|phosphopantetheine}} | ||
| + | {{#set: consumed by=PANTEPADENYLYLTRAN-RXN}} | ||
| + | {{#set: produced by=3.1.4.14-RXN|P-PANTOCYSDECARB-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-10811}} | ||
Latest revision as of 18:59, 21 March 2018
Contents
Metabolite PANTETHEINE-P
- smiles:
- CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-]
- inchi key:
- InChIKey=JDMUPRLRUUMCTL-VIFPVBQESA-L
- common name:
- 4'-phosphopantetheine
- molecular weight:
- 356.33
- Synonym(s):
- phosphopantotheine
- pantetheine 4'-phosphate
- phosphopantetheine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 36886
- PUBCHEM:
- HMDB : HMDB01416
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC61723
"CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.
