Difference between revisions of "PWY-6435"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] == * smiles: ** C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6435 PWY-6435] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6435 PWY-6435] ==
* smiles:
+
* taxonomic range:
** C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=C4(C(CCC([O-])=O)=C(C)C(=CC3(C(C=C)=C(C)C(=CC=1N2)N=3))N4))=N5)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=KSFOVUSSGSKXFI-UJJXFSCMSA-L
+
 
* common name:
 
* common name:
** protoporphyrin IX
+
** 4-hydroxybenzoate biosynthesis V
* molecular weight:
+
** 560.651   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN1F-20]]
+
'''3''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
* [[PROTOPORGENOXI-RXN]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-10_001480]]
* [[PROTOHEMEFERROCHELAT-RXN]]
+
*** [[Ec-04_001280]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXN-11244]]
 +
** 4 associated gene(s):
 +
*** [[Ec-06_001380]]
 +
*** [[Ec-16_001250]]
 +
*** [[Ec-16_003560]]
 +
*** [[Ec-14_006530]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11245]]
 +
** 2 associated gene(s):
 +
*** [[Ec-19_005290]]
 +
*** [[Ec-14_006530]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.23-RXN 3.1.2.23-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11246 RXN-11246]
 
== External links  ==
 
== External links  ==
* CAS : 553-12-8
+
{{#set: taxonomic range=TAX-33090}}
* PUBCHEM:
+
{{#set: common name=4-hydroxybenzoate biosynthesis V}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3794562 3794562]
+
{{#set: reaction found=3}}
* HMDB : HMDB00241
+
{{#set: total reaction=5}}
* LIGAND-CPD:
+
{{#set: completion rate=60.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C02191 C02191]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.20171337.html 20171337]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57306 57306]
+
* BIGG : 39293
+
{{#set: smiles=C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=C4(C(CCC([O-])=O)=C(C)C(=CC3(C(C=C)=C(C)C(=CC=1N2)N=3))N4))=N5)))}}
+
{{#set: inchi key=InChIKey=KSFOVUSSGSKXFI-UJJXFSCMSA-L}}
+
{{#set: common name=protoporphyrin IX}}
+
{{#set: molecular weight=560.651    }}
+
{{#set: consumed by=RXN1F-20}}
+
{{#set: produced by=PROTOPORGENOXI-RXN}}
+
{{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}}
+

Latest revision as of 19:00, 21 March 2018

Pathway PWY-6435

  • taxonomic range:
  • common name:
    • 4-hydroxybenzoate biosynthesis V
  • Synonym(s):

Reaction(s) found

3 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links