Difference between revisions of "CPD-10330"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PNPOXI-RXN PNPOXI-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** pyridoxamine-phosphate ox...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * inchi key: ** InChIKey=HMFHBZSHGG...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PNPOXI-RXN PNPOXI-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C1(C(C(C(O1)O)O)O))O
 +
* inchi key:
 +
** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
 
* common name:
 
* common name:
−
** pyridoxamine-phosphate oxidase
+
** α-D-ribofuranose
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.4.3.5 EC-1.4.3.5]
+
** 150.131   
 
* Synonym(s):
 
* Synonym(s):
 +
** α D-ribose
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RIBOKIN-RXN]]
−
** 1 [[PYRIDOXINE-5P]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[PYRIDOXAL_PHOSPHATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 pyridoxine 5'-phosphate[c] '''+''' 1 oxygen[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 pyridoxal 5'-phosphate[c]
+
* [[RXN-14904]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-01_000340]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
* Gene: [[Ec-09_002030]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
* Gene: [[Ec-10_006030]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-7204]], pyridoxal 5'-phosphate salvage II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204]
+
−
** '''5''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7282]], 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282]
+
−
** '''5''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PLPSAL-PWY]], pyridoxal 5'-phosphate salvage I: [http://metacyc.org/META/NEW-IMAGE?object=PLPSAL-PWY PLPSAL-PWY]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PYRIDOXSYN-PWY]], pyridoxal 5'-phosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXSYN-PWY PYRIDOXSYN-PWY]
+
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15149 15149]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00278 R00278]
+
** [http://www.chemspider.com/Chemical-Structure.5575.html 5575]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=pyridoxamine-phosphate oxidase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506]
−
{{#set: ec number=EC-1.4.3.5}}
+
* HMDB : HMDB00283
−
{{#set: gene associated=Ec-01_000340|Ec-09_002030|Ec-10_006030}}
+
{{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}}
−
{{#set: in pathway=PWY-7204|PWY-7282|PLPSAL-PWY|PYRIDOXSYN-PWY}}
+
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=α-D-ribofuranose}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: molecular weight=150.131    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=α D-ribose}}
 +
{{#set: consumed by=RIBOKIN-RXN}}
 +
{{#set: reversible reaction associated=RXN-14904}}

Latest revision as of 19:00, 21 March 2018

Metabolite CPD-10330

  • smiles:
    • C(C1(C(C(C(O1)O)O)O))O
  • inchi key:
    • InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
  • common name:
    • α-D-ribofuranose
  • molecular weight:
    • 150.131
  • Synonym(s):
    • α D-ribose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-10330&oldid=23742"