Difference between revisions of "PWY-6907"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] == * smiles: ** C2(C1(O)(NC(=O)NC1=NC(=O)N2))(=O) * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6907 PWY-6907] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6907 PWY-6907] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** thiamine diphosphate biosynthesis III (Staphylococcus) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** vitamin B1 biosynthesis III | ||
| + | ** thiamin diphosphate biosynthesis III (Staphylococcus) | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] | |
| − | * [[ | + | ** 1 associated gene(s): |
| − | == Reaction(s) | + | *** [[Ec-06_002580]] |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12610 RXN-12610] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4191 RXNQT-4191] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=thiamine diphosphate biosynthesis III (Staphylococcus)}} | |
| − | + | {{#set: common name=vitamin B1 biosynthesis III|thiamin diphosphate biosynthesis III (Staphylococcus)}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:01, 21 March 2018
Pathway PWY-6907
- taxonomic range:
- common name:
- thiamine diphosphate biosynthesis III (Staphylococcus)
- Synonym(s):
- vitamin B1 biosynthesis III
- thiamin diphosphate biosynthesis III (Staphylococcus)
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- THIAMIN-PYROPHOSPHOKINASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
