Difference between revisions of "Ec-14 004210"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...")
(Created page with "Category:Gene == Gene Ec-14_004210 == * left end position: ** 3938478 * transcription direction: ** NEGATIVE * right end position: ** 3940302 * centisome position: ** 60.0...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
+
== Gene Ec-14_004210 ==
−
* smiles:
+
* left end position:
−
** C(CC[N+]CCCCC[N+])[N+]
+
** 3938478
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** aminopropylcadaverine
+
** 3940302
−
* molecular weight:
+
* centisome position:
−
** 162.298    
+
** 60.03386    
 
* Synonym(s):
 
* Synonym(s):
−
** N-3-aminopropyl-1,5-diaminopentane
+
** Esi_0099_0038
 +
** Esi0099_0038
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GLYOXIII-RXN]]
−
* [[RXN0-5217]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3938478}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=3940302}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
+
{{#set: centisome position=60.03386   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0099_0038|Esi0099_0038}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
+
{{#set: reaction associated=GLYOXIII-RXN}}
−
* HMDB : HMDB12189
+
−
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
+
−
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
+
−
{{#set: common name=aminopropylcadaverine}}
+
−
{{#set: molecular weight=162.298   }}
+
−
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
+
−
{{#set: produced by=RXN0-5217}}
+

Latest revision as of 19:01, 21 March 2018

Gene Ec-14_004210

  • left end position:
    • 3938478
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3940302
  • centisome position:
    • 60.03386
  • Synonym(s):
    • Esi_0099_0038
    • Esi0099_0038

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_004210&oldid=23941"