Difference between revisions of "PWY-4381"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CMP CMP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP([O-])([O-])=O * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** fatty acid biosynthesis initiation I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** de novo fatty acid biosynthesis, initial reactions |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''2''' reactions found over '''3''' reactions in the full pathway |
| − | * [[ | + | * [[ACETYL-COA-CARBOXYLTRANSFER-RXN]] |
| − | + | ** 7 associated gene(s): | |
| − | * [[ | + | *** [[Ec-19_003040]] |
| − | * [[ | + | *** [[Ec-03_001890]] |
| − | * [[ | + | *** [[Ec-14_002460]] |
| − | * [[ | + | *** [[Ec-01_009720]] |
| − | * [[ | + | *** [[Ec-01_010970]] |
| − | * [[ | + | *** [[Ec-19_003230]] |
| − | * [[ | + | *** [[Ec-20_002520]] |
| − | * [[RXN | + | ** 2 reconstruction source(s) associated: |
| − | + | *** [[annotation-esiliculosus_genome]] | |
| − | * [[ | + | *** [[orthology-aragem]] |
| − | * [[ | + | * [[MALONYL-COA-ACP-TRANSACYL-RXN]] |
| − | * [ | + | ** 1 associated gene(s): |
| + | *** [[Ec-05_003450]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.180-RXN 2.3.1.180-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-4381 PWY-4381] | |
| − | + | * ARACYC: | |
| − | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-4381 PWY-4381] |
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=fatty acid biosynthesis initiation I}} | |
| − | * | + | {{#set: common name=de novo fatty acid biosynthesis, initial reactions}} |
| − | ** [http:// | + | {{#set: reaction found=2}} |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=67.0}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:02, 21 March 2018
Pathway PWY-4381
- taxonomic range:
- common name:
- fatty acid biosynthesis initiation I
- Synonym(s):
- de novo fatty acid biosynthesis, initial reactions
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- ACETYL-COA-CARBOXYLTRANSFER-RXN
- 7 associated gene(s):
- 2 reconstruction source(s) associated:
- MALONYL-COA-ACP-TRANSACYL-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
