Difference between revisions of "CPD-12906"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5168 CPD-5168] == * common name: ** a (mannosyl)9-(N-acetylglucosaminyl)2-diphosphodolichol...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] == * smiles: ** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] == |
+ | * smiles: | ||
+ | ** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 5-methyl-3-oxo-4-hexenoyl-CoA |
+ | * molecular weight: | ||
+ | ** 887.641 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11921]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986120 50986120] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16471 C16471] |
+ | * HMDB : HMDB60399 | ||
+ | {{#set: smiles=CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J}} | ||
+ | {{#set: common name=5-methyl-3-oxo-4-hexenoyl-CoA}} | ||
+ | {{#set: molecular weight=887.641 }} | ||
+ | {{#set: consumed by=RXN-11921}} |
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite CPD-12906
- smiles:
- CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J
- common name:
- 5-methyl-3-oxo-4-hexenoyl-CoA
- molecular weight:
- 887.641
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.