Difference between revisions of "CPD-18348"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * smiles: ** C(CC1(C=C(C(=CC=1)O)O))[N+] * inchi key: ** InChIKey=VYFYYTL...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18348 CPD-18348] == * smiles: ** CCCCCCC=CCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])O * inchi key...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18348 CPD-18348] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCC=CCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=LWSYATLSXCUNTB-FPLPWBNLSA-L |
* common name: | * common name: | ||
− | ** | + | ** 1-cis-vaccenoylglycerol-3-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 434.509 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (Z)-octadec-11-enoylglycerol 3-phosphate |
− | + | ** (Z)-11-octadecenoic acylglycerol 3-phosphate | |
− | ** 3 | + | ** cis-11-octadecenoic acylglycerol 3-phosphate |
− | ** | + | ** cis-octadec-11-enoic acylglycerol 3-phosphate |
− | + | ||
− | ** | + | |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-17011]] |
− | * [[ | + | * [[RXN-17013]] |
− | * [[ | + | * [[RXN-17009]] |
+ | * [[RXN-17015]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-17016]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: smiles=CCCCCCC=CCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])O}} | |
− | + | {{#set: inchi key=InChIKey=LWSYATLSXCUNTB-FPLPWBNLSA-L}} | |
− | + | {{#set: common name=1-cis-vaccenoylglycerol-3-phosphate}} | |
− | + | {{#set: molecular weight=434.509 }} | |
− | + | {{#set: common name=(Z)-octadec-11-enoylglycerol 3-phosphate|(Z)-11-octadecenoic acylglycerol 3-phosphate|cis-11-octadecenoic acylglycerol 3-phosphate|cis-octadec-11-enoic acylglycerol 3-phosphate}} | |
− | + | {{#set: consumed by=RXN-17011|RXN-17013|RXN-17009|RXN-17015}} | |
− | + | {{#set: produced by=RXN-17016}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: smiles= | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + |
Latest revision as of 20:02, 21 March 2018
Contents
Metabolite CPD-18348
- smiles:
- CCCCCCC=CCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])O
- inchi key:
- InChIKey=LWSYATLSXCUNTB-FPLPWBNLSA-L
- common name:
- 1-cis-vaccenoylglycerol-3-phosphate
- molecular weight:
- 434.509
- Synonym(s):
- (Z)-octadec-11-enoylglycerol 3-phosphate
- (Z)-11-octadecenoic acylglycerol 3-phosphate
- cis-11-octadecenoic acylglycerol 3-phosphate
- cis-octadec-11-enoic acylglycerol 3-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])O" cannot be used as a page name in this wiki.