Difference between revisions of "PWY-5532"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5532 PWY-5532] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5532 PWY-5532] ==
* smiles:
+
* taxonomic range:
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
+
 
* common name:
 
* common name:
** gibberellin A15 (open lactone form)
+
** nucleoside and nucleotide degradation (archaea)
* molecular weight:
+
** 346.422   
+
 
* Synonym(s):
 
* Synonym(s):
** gibberellin A15
 
** GA15
 
** GA15 (open lactone form)
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN1F-163]]
+
'''2''' reactions found over '''10''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[CYTIKIN-RXN]]
* [[RXN1F-162]]
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-12_007560]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ADENPHOSPHOR-RXN ADENPHOSPHOR-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14699 RXN-14699]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14700 RXN-14700]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17337 RXN-17337]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8800 RXN-8800]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8801 RXN-8801]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5199 RXN0-5199]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=URPHOS-RXN URPHOS-RXN]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170017
+
{{#set: taxonomic range=TAX-2157}}
* PUBCHEM:
+
{{#set: common name=nucleoside and nucleotide degradation (archaea)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245948 25245948]
+
{{#set: reaction found=2}}
* CHEBI:
+
{{#set: total reaction=10}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29590 29590]
+
{{#set: completion rate=20.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11860 C11860]
+
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L}}
+
{{#set: common name=gibberellin A15 (open lactone form)}}
+
{{#set: molecular weight=346.422    }}
+
{{#set: common name=gibberellin A15|GA15|GA15 (open lactone form)}}
+
{{#set: consumed by=RXN1F-163}}
+
{{#set: produced by=RXN1F-162}}
+

Latest revision as of 19:02, 21 March 2018

Pathway PWY-5532

  • taxonomic range:
  • common name:
    • nucleoside and nucleotide degradation (archaea)
  • Synonym(s):

Reaction(s) found

2 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links