|
|
| Line 1: |
Line 1: |
| − | [[Category:Reaction]] | + | [[Category:Metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRODIPICSYN-RXN DIHYDRODIPICSYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] == |
| − | * direction: | + | * smiles: |
| − | ** LEFT-TO-RIGHT | + | ** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO |
| − | * ec number: | + | * inchi key: |
| − | ** [http://enzyme.expasy.org/EC/4.3.3.7 EC-4.3.3.7] | + | ** InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N |
| | + | * common name: |
| | + | ** cis-zeatin-7-N-glucoside |
| | + | * molecular weight: |
| | + | ** 381.388 |
| | * Synonym(s): | | * Synonym(s): |
| − | ** dihydropicolinate synthetase
| |
| − | ** dihydrodipicolinic acid synthase
| |
| | | | |
| − | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
| − | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
| − | ** 1 [[PYRUVATE]][c] '''+''' 1 [[L-ASPARTATE-SEMIALDEHYDE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-14443]][c] '''+''' 1 [[PROTON]][c]
| + | * [[RXN-4733]] |
| − | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
| − | ** 1 pyruvate[c] '''+''' 1 L-aspartate-semialdehyde[c] '''=>''' 1 H2O[c] '''+''' 1 (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate[c] '''+''' 1 H+[c]
| + | |
| − | | + | |
| − | == Genes associated with this reaction ==
| + | |
| − | == Pathways == | + | |
| − | * [[PWY-5097]], L-lysine biosynthesis VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5097 PWY-5097]
| + | |
| − | ** '''7''' reactions found over '''7''' reactions in the full pathway
| + | |
| − | * [[PWY-2942]], L-lysine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2942 PWY-2942]
| + | |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| + | |
| − | * [[DAPLYSINESYN-PWY]], L-lysine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=DAPLYSINESYN-PWY DAPLYSINESYN-PWY]
| + | |
| − | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
| − | * [[PWY-2941]], L-lysine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2941 PWY-2941] | + | |
| − | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
| − | == Reconstruction information == | + | |
| − | * Category: [[gap-filling]]
| + | |
| − | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
| + | |
| − | *** Tool: [[meneco]]
| + | |
| − | **** Comment: [[added for gapfilling]]
| + | |
| | == External links == | | == External links == |
| − | * LIGAND-RXN: | + | * PUBCHEM: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R10147 R10147] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244153 25244153] |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02292 R02292]
| + | * HMDB : HMDB12201 |
| − | * UNIPROT: | + | {{#set: smiles=CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO}} |
| − | ** [http://www.uniprot.org/uniprot/P43797 P43797]
| + | {{#set: inchi key=InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N}} |
| − | ** [http://www.uniprot.org/uniprot/O26892 O26892]
| + | {{#set: common name=cis-zeatin-7-N-glucoside}} |
| − | ** [http://www.uniprot.org/uniprot/Q9Z6K9 Q9Z6K9]
| + | {{#set: molecular weight=381.388 }} |
| − | ** [http://www.uniprot.org/uniprot/Q9X1K9 Q9X1K9]
| + | {{#set: produced by=RXN-4733}} |
| − | ** [http://www.uniprot.org/uniprot/P19808 P19808]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9ZM13 Q9ZM13]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O05969 O05969]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9CF61 Q9CF61]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q04796 Q04796]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q57695 Q57695]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O25657 O25657]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O67216 O67216]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O29352 O29352]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O84366 O84366]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9PPB4 Q9PPB4]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P63945 P63945]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9JUU9 Q9JUU9]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9LZX6 Q9LZX6]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q43038 Q43038]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P49423 P49423]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q55513 Q55513]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P0A6L2 P0A6L2]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q42948 Q42948]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q42940 Q42940]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O86841 O86841]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P24847 P24847]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P24846 P24846]
| + | |
| − | {{#set: direction=LEFT-TO-RIGHT}} | + | |
| − | {{#set: ec number=EC-4.3.3.7}} | + | |
| − | {{#set: common name=dihydropicolinate synthetase|dihydrodipicolinic acid synthase}} | + | |
| − | {{#set: in pathway=PWY-5097|PWY-2942|DAPLYSINESYN-PWY|PWY-2941}}
| + | |
| − | {{#set: reconstruction category=gap-filling}} | + | |
| − | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} | + | |
| − | {{#set: reconstruction tool=meneco}}
| + | |
| − | {{#set: reconstruction comment=added for gapfilling}}
| + | |
