Difference between revisions of "Ec-26 006130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * smiles: ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-26_006130 == * left end position: ** 6140837 * transcription direction: ** POSITIVE * right end position: ** 6154064 * centisome position: ** 93.2...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-26_006130 == |
− | * | + | * left end position: |
− | ** | + | ** 6140837 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 6154064 |
− | * | + | * centisome position: |
− | ** | + | ** 93.27833 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0059_0043 | ||
+ | ** Esi0059_0043 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[4-NITROPHENYLPHOSPHATASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: go-term | |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=6140837}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=6154064}} | |
− | + | {{#set: centisome position=93.27833 }} | |
− | + | {{#set: common name=Esi_0059_0043|Esi0059_0043}} | |
− | + | {{#set: reaction associated=4-NITROPHENYLPHOSPHATASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:12, 21 March 2018
Gene Ec-26_006130
- left end position:
- 6140837
- transcription direction:
- POSITIVE
- right end position:
- 6154064
- centisome position:
- 93.27833
- Synonym(s):
- Esi_0059_0043
- Esi0059_0043
Reactions associated
- Reaction: 4-NITROPHENYLPHOSPHATASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome