Difference between revisions of "Ec-01 003780"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] == * smiles: ** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-]...")
(Created page with "Category:Gene == Gene Ec-01_003780 == * left end position: ** 3149563 * transcription direction: ** POSITIVE * right end position: ** 3152750 * centisome position: ** 30.5...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] ==
+
== Gene Ec-01_003780 ==
−
* smiles:
+
* left end position:
−
** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))
+
** 3149563
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H
+
** POSITIVE
−
* common name:
+
* right end position:
−
** cob(I)yrinate a,c-diamide
+
** 3152750
−
* molecular weight:
+
* centisome position:
−
** 931.9    
+
** 30.522469    
 
* Synonym(s):
 
* Synonym(s):
−
** cob(I)yrinic acid a,c-diamide
+
** Esi_0003_0314
−
** Cob(I)yrinate diamide
+
** Esi0003_0314
 +
** STE1
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[R344-RXN]]
+
* Reaction: [[1.14.21.6-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-11887]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13883]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13892]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16378]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-4209]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN3O-218]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY66-341]]
 +
* [[PWY-7154]]
 +
* [[PWY-7155]]
 +
* [[PWY-2541]]
 +
* [[PWY-6075]]
 +
* [[PWY66-3]]
 +
* [[PWY66-4]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3149563}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266689 45266689]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3152750}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58575 58575]
+
{{#set: centisome position=30.522469   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0003_0314|Esi0003_0314|STE1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06505 C06505]
+
{{#set: reaction associated=1.14.21.6-RXN|RXN-11887|RXN-13883|RXN-13892|RXN-16378|RXN-4209|RXN3O-218}}
−
* HMDB : HMDB06904
+
{{#set: pathway associated=PWY66-341|PWY-7154|PWY-7155|PWY-2541|PWY-6075|PWY66-3|PWY66-4}}
−
{{#set: smiles=CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))}}
+
−
{{#set: inchi key=InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H}}
+
−
{{#set: common name=cob(I)yrinate a,c-diamide}}
+
−
{{#set: molecular weight=931.9   }}
+
−
{{#set: common name=cob(I)yrinic acid a,c-diamide|Cob(I)yrinate diamide}}
+
−
{{#set: consumed by=R344-RXN}}
+

Latest revision as of 19:02, 21 March 2018

Gene Ec-01_003780

  • left end position:
    • 3149563
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3152750
  • centisome position:
    • 30.522469
  • Synonym(s):
    • Esi_0003_0314
    • Esi0003_0314
    • STE1

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_003780&oldid=24126"