Difference between revisions of "GLC-6-P"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-05_001980 == * left end position: ** 3509270 * transcription direction: ** POSITIVE * right end position: ** 3518850 * centisome position: ** 38.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L |
− | * | + | * common name: |
− | ** | + | ** β-D-glucose 6-phosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** β-D-glucose-6-P |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN66-579]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865] |
− | {{#set: | + | * HMDB : HMDB03498 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247] | ||
+ | * BIGG : 36977 | ||
+ | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}} | ||
+ | {{#set: common name=β-D-glucose 6-phosphate}} | ||
+ | {{#set: molecular weight=258.121 }} | ||
+ | {{#set: common name=β-D-glucose-6-P}} | ||
+ | {{#set: consumed by=RXN66-579}} |
Latest revision as of 19:03, 21 March 2018
Contents
Metabolite GLC-6-P
- smiles:
- C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
- common name:
- β-D-glucose 6-phosphate
- molecular weight:
- 258.121
- Synonym(s):
- β-D-glucose-6-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB03498
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 36977
"C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.