Difference between revisions of "Ec-01 012040"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17331 CPD-17331] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(Created page with "Category:Gene == Gene Ec-01_012040 == * left end position: ** 10033167 * transcription direction: ** NEGATIVE * right end position: ** 10037846 * centisome position: ** 97...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17331 CPD-17331] ==
+
== Gene Ec-01_012040 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 10033167
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BNAMTMVBOVNNSH-AFQBPCMKSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA
+
** 10037846
−
* molecular weight:
+
* centisome position:
−
** 1104.05    
+
** 97.2316    
 
* Synonym(s):
 
* Synonym(s):
−
** tetracosapentaenoyl-CoA
+
** Esi_0008_0045
−
** all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA
+
** Esi0008_0045
−
** (9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16132]]
+
* Reaction: [[3.1.3.16-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-16131]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=10033167}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581213 71581213]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=10037846}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74083 74083]
+
{{#set: centisome position=97.2316   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: common name=Esi_0008_0045|Esi0008_0045}}
−
{{#set: inchi key=InChIKey=BNAMTMVBOVNNSH-AFQBPCMKSA-J}}
+
{{#set: reaction associated=3.1.3.16-RXN}}
−
{{#set: common name=(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA}}
+
−
{{#set: molecular weight=1104.05   }}
+
−
{{#set: common name=tetracosapentaenoyl-CoA|all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA|(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16132}}
+
−
{{#set: produced by=RXN-16131}}
+

Latest revision as of 19:12, 21 March 2018

Gene Ec-01_012040

  • left end position:
    • 10033167
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 10037846
  • centisome position:
    • 97.2316
  • Synonym(s):
    • Esi_0008_0045
    • Esi0008_0045

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_012040&oldid=25303"